C11H16N4O — CID 43518467
4-N-(3-methylbutyl)-2,1,3-benzoxadiazole-4,7-diamine (PubChem CID 43518467) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 4-N-(3-methylbutyl)-2,1,3-benzoxadiazole-4,7-diamine.
| Compound Name | 4-N-(3-methylbutyl)-2,1,3-benzoxadiazole-4,7-diamine |
|---|---|
| PubChem CID | 43518467 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 4-N-(3-methylbutyl)-2,1,3-benzoxadiazole-4,7-diamine |
| SMILES | CC(C)CCNc1ccc(N)c2nonc12 |
| InChI | InChI=1S/C11H16N4O/c1-7(2)5-6-13-9-4-3-8(12)10-11(9)15-16-14-10/h3-4,7,13H,5-6,12H2,1-2H3 |
| InChIKey | NPLOBSGZHMEDON-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|