C9H10F2N4O2 — CID 114093028
3-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]-1,1-difluoropropan-2-ol (PubChem CID 114093028) has the molecular formula C9H10F2N4O2 and a molecular weight of 244.20 g/mol. Its IUPAC name is 3-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]-1,1-difluoropropan-2-ol.
| Compound Name | 3-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 114093028 |
| Molecular Formula | C9H10F2N4O2 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]-1,1-difluoropropan-2-ol |
| SMILES | Nc1ccc(NCC(O)C(F)F)c2nonc12 |
| InChI | InChI=1S/C9H10F2N4O2/c10-9(11)6(16)3-13-5-2-1-4(12)7-8(5)15-17-14-7/h1-2,6,9,13,16H,3,12H2 |
| InChIKey | UWBMEQDHLGEEQU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|