C11H14N4OS — CID 80585168
4-N-(thiolan-2-ylmethyl)-2,1,3-benzoxadiazole-4,7-diamine (PubChem CID 80585168) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 4-N-(thiolan-2-ylmethyl)-2,1,3-benzoxadiazole-4,7-diamine.
| Compound Name | 4-N-(thiolan-2-ylmethyl)-2,1,3-benzoxadiazole-4,7-diamine |
|---|---|
| PubChem CID | 80585168 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 4-N-(thiolan-2-ylmethyl)-2,1,3-benzoxadiazole-4,7-diamine |
| SMILES | Nc1ccc(NCC2CCCS2)c2nonc12 |
| InChI | InChI=1S/C11H14N4OS/c12-8-3-4-9(11-10(8)14-16-15-11)13-6-7-2-1-5-17-7/h3-4,7,13H,1-2,5-6,12H2 |
| InChIKey | KUJQKEPMFDHLBW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|