C10H14N4O2 — CID 65103255
1-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]-2-methylpropan-2-ol (PubChem CID 65103255) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 1-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]-2-methylpropan-2-ol.
| Compound Name | 1-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 65103255 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 1-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)CNc1ccc(N)c2nonc12 |
| InChI | InChI=1S/C10H14N4O2/c1-10(2,15)5-12-7-4-3-6(11)8-9(7)14-16-13-8/h3-4,12,15H,5,11H2,1-2H3 |
| InChIKey | NXKZMRYTIYLAOW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|