C12H17N5O2 — CID 115356002
2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]-N-tert-butylacetamide (PubChem CID 115356002) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]-N-tert-butylacetamide.
| Compound Name | 2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 115356002 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-[(7-amino-2,1,3-benzoxadiazol-4-yl)amino]-N-tert-butylacetamide |
| SMILES | CC(C)(C)NC(=O)CNc1ccc(N)c2nonc12 |
| InChI | InChI=1S/C12H17N5O2/c1-12(2,3)15-9(18)6-14-8-5-4-7(13)10-11(8)17-19-16-10/h4-5,14H,6,13H2,1-3H3,(H,15,18) |
| InChIKey | TWCXAGUURMTEDL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|