4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid

C12H23NO3 — CID 62042182

IUPAC4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid
SMILESCC(C)(C)CC(=O)NC(C)(C)CCC(=O)O
InChIInChI=1S/C12H23NO3/c1-11(2,3)8-9(14)13-12(4,5)7-6-10(15)16/h6-8H2,1-5H3,(H,13,14)(H,15,16)
InChIKeyLYUOXRFLESUPRU-UHFFFAOYSA-N
MW229.32 g/mol
LogP2.18
Rot. Bonds5

About 4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid

4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid (PubChem CID 62042182) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid.

Molecular Properties

Compound Name4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid
PubChem CID62042182
Molecular FormulaC12H23NO3
Molecular Weight229.32 g/mol
Exact Mass229.17
IUPAC Name4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid
SMILESCC(C)(C)CC(=O)NC(C)(C)CCC(=O)O
InChIInChI=1S/C12H23NO3/c1-11(2,3)8-9(14)13-12(4,5)7-6-10(15)16/h6-8H2,1-5H3,(H,13,14)(H,15,16)
InChIKeyLYUOXRFLESUPRU-UHFFFAOYSA-N
XLogP2.18
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.32
LogP ≤ 52.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid?
The IUPAC name of 4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid (CID 62042182) is 4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid.
What is the SMILES notation for 4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid?
The canonical SMILES for 4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid is CC(C)(C)CC(=O)NC(C)(C)CCC(=O)O.
What is the InChIKey of 4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid?
The InChIKey is LYUOXRFLESUPRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-11(2,3)8-9(14)13-12(4,5)7-6-10(15)16/h6-8H2,1-5H3,(H,13,14)(H,15,16).
What are the key properties of 4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid?
4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid has a molecular weight of 229.32 g/mol, XLogP of 2.18, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-dimethylbutanoylamino)-4-methylpentanoic acid is sourced from PubChem (CID 62042182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).