About N-ethyl-1-(2,4,6-trimethylphenoxy)pentan-2-amine
N-ethyl-1-(2,4,6-trimethylphenoxy)pentan-2-amine (PubChem CID 62042780) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is N-ethyl-1-(2,4,6-trimethylphenoxy)pentan-2-amine.
Molecular Properties
| Compound Name | N-ethyl-1-(2,4,6-trimethylphenoxy)pentan-2-amine |
| PubChem CID | 62042780 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N-ethyl-1-(2,4,6-trimethylphenoxy)pentan-2-amine |
| SMILES | CCCC(COc1c(C)cc(C)cc1C)NCC |
| InChI | InChI=1S/C16H27NO/c1-6-8-15(17-7-2)11-18-16-13(4)9-12(3)10-14(16)5/h9-10,15,17H,6-8,11H2,1-5H3 |
| InChIKey | CBHCSDFBVXLVBZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-1-(2,4,6-trimethylphenoxy)pentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1-(2,4,6-trimethylphenoxy)pentan-2-amine?
The IUPAC name of N-ethyl-1-(2,4,6-trimethylphenoxy)pentan-2-amine (CID 62042780) is N-ethyl-1-(2,4,6-trimethylphenoxy)pentan-2-amine.
What is the SMILES notation for N-ethyl-1-(2,4,6-trimethylphenoxy)pentan-2-amine?
The canonical SMILES for N-ethyl-1-(2,4,6-trimethylphenoxy)pentan-2-amine is CCCC(COc1c(C)cc(C)cc1C)NCC.
What is the InChIKey of N-ethyl-1-(2,4,6-trimethylphenoxy)pentan-2-amine?
The InChIKey is CBHCSDFBVXLVBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO/c1-6-8-15(17-7-2)11-18-16-13(4)9-12(3)10-14(16)5/h9-10,15,17H,6-8,11H2,1-5H3.
What are the key properties of N-ethyl-1-(2,4,6-trimethylphenoxy)pentan-2-amine?
N-ethyl-1-(2,4,6-trimethylphenoxy)pentan-2-amine has a molecular weight of 249.40 g/mol, XLogP of 3.77, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1-(2,4,6-trimethylphenoxy)pentan-2-amine is sourced from PubChem (CID 62042780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).