4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid

C11H21NO3 — CID 62042823

IUPAC4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid
SMILESCC(C)(CCC(=O)O)NC(=O)C(C)(C)C
InChIInChI=1S/C11H21NO3/c1-10(2,3)9(15)12-11(4,5)7-6-8(13)14/h6-7H2,1-5H3,(H,12,15)(H,13,14)
InChIKeyMWKAHSPUAAGVFM-UHFFFAOYSA-N
MW215.29 g/mol
LogP1.79
Rot. Bonds4

About 4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid

4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid (PubChem CID 62042823) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid.

Molecular Properties

Compound Name4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid
PubChem CID62042823
Molecular FormulaC11H21NO3
Molecular Weight215.29 g/mol
Exact Mass215.15
IUPAC Name4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid
SMILESCC(C)(CCC(=O)O)NC(=O)C(C)(C)C
InChIInChI=1S/C11H21NO3/c1-10(2,3)9(15)12-11(4,5)7-6-8(13)14/h6-7H2,1-5H3,(H,12,15)(H,13,14)
InChIKeyMWKAHSPUAAGVFM-UHFFFAOYSA-N
XLogP1.79
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.29
LogP ≤ 51.79
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid?
The IUPAC name of 4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid (CID 62042823) is 4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid.
What is the SMILES notation for 4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid?
The canonical SMILES for 4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid is CC(C)(CCC(=O)O)NC(=O)C(C)(C)C.
What is the InChIKey of 4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid?
The InChIKey is MWKAHSPUAAGVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-10(2,3)9(15)12-11(4,5)7-6-8(13)14/h6-7H2,1-5H3,(H,12,15)(H,13,14).
What are the key properties of 4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid?
4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid has a molecular weight of 215.29 g/mol, XLogP of 1.79, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid is sourced from PubChem (CID 62042823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).