C11H21NO3 — CID 62042823
4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid (PubChem CID 62042823) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid.
| Compound Name | 4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 62042823 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 4-(2,2-dimethylpropanoylamino)-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H21NO3/c1-10(2,3)9(15)12-11(4,5)7-6-8(13)14/h6-7H2,1-5H3,(H,12,15)(H,13,14) |
| InChIKey | MWKAHSPUAAGVFM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |