C13H18ClNO4 — CID 62051250
2-[bis(2-hydroxyethyl)amino]-1-(3-chloro-4-methoxyphenyl)ethanone (PubChem CID 62051250) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]-1-(3-chloro-4-methoxyphenyl)ethanone.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]-1-(3-chloro-4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 62051250 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]-1-(3-chloro-4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CN(CCO)CCO)cc1Cl |
| InChI | InChI=1S/C13H18ClNO4/c1-19-13-3-2-10(8-11(13)14)12(18)9-15(4-6-16)5-7-17/h2-3,8,16-17H,4-7,9H2,1H3 |
| InChIKey | FNAFEGTXYWEBRG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |