C12H15ClN2O3 — CID 62052942
2-[[2-(3-chloro-4-methoxyphenyl)-2-oxoethyl]-methylamino]acetamide (PubChem CID 62052942) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 2-[[2-(3-chloro-4-methoxyphenyl)-2-oxoethyl]-methylamino]acetamide.
| Compound Name | 2-[[2-(3-chloro-4-methoxyphenyl)-2-oxoethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 62052942 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-[[2-(3-chloro-4-methoxyphenyl)-2-oxoethyl]-methylamino]acetamide |
| SMILES | COc1ccc(C(=O)CN(C)CC(N)=O)cc1Cl |
| InChI | InChI=1S/C12H15ClN2O3/c1-15(7-12(14)17)6-10(16)8-3-4-11(18-2)9(13)5-8/h3-5H,6-7H2,1-2H3,(H2,14,17) |
| InChIKey | PNOSDLQDPYDNJZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |