C9H7Br3N4 — CID 62053597
[1-(2,4,6-tribromophenyl)triazol-4-yl]methanamine (PubChem CID 62053597) has the molecular formula C9H7Br3N4 and a molecular weight of 410.90 g/mol. Its IUPAC name is [1-(2,4,6-tribromophenyl)triazol-4-yl]methanamine.
| Compound Name | [1-(2,4,6-tribromophenyl)triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 62053597 |
| Molecular Formula | C9H7Br3N4 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 407.82 |
| IUPAC Name | [1-(2,4,6-tribromophenyl)triazol-4-yl]methanamine |
| SMILES | NCc1cn(-c2c(Br)cc(Br)cc2Br)nn1 |
| InChI | InChI=1S/C9H7Br3N4/c10-5-1-7(11)9(8(12)2-5)16-4-6(3-13)14-15-16/h1-2,4H,3,13H2 |
| InChIKey | MCQJJJDQNMVSGN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |