C13H17N3O3S — CID 62058325
7-amino-N-(3-methylsulfonylpropyl)-1H-indole-2-carboxamide (PubChem CID 62058325) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 7-amino-N-(3-methylsulfonylpropyl)-1H-indole-2-carboxamide.
| Compound Name | 7-amino-N-(3-methylsulfonylpropyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 62058325 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 7-amino-N-(3-methylsulfonylpropyl)-1H-indole-2-carboxamide |
| SMILES | CS(=O)(=O)CCCNC(=O)c1cc2cccc(N)c2[nH]1 |
| InChI | InChI=1S/C13H17N3O3S/c1-20(18,19)7-3-6-15-13(17)11-8-9-4-2-5-10(14)12(9)16-11/h2,4-5,8,16H,3,6-7,14H2,1H3,(H,15,17) |
| InChIKey | NKIKXYYGMMJMQT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|