C16H24N4O — CID 63117459
7-amino-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1H-indole-2-carboxamide (PubChem CID 63117459) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is 7-amino-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1H-indole-2-carboxamide.
| Compound Name | 7-amino-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 63117459 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 7-amino-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1H-indole-2-carboxamide |
| SMILES | CN(C)CC(C)(C)CNC(=O)c1cc2cccc(N)c2[nH]1 |
| InChI | InChI=1S/C16H24N4O/c1-16(2,10-20(3)4)9-18-15(21)13-8-11-6-5-7-12(17)14(11)19-13/h5-8,19H,9-10,17H2,1-4H3,(H,18,21) |
| InChIKey | HVTPLWBEUCDINE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|