C17H24N2O — CID 62065627
1-benzyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)pyrrolidin-3-amine (PubChem CID 62065627) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-benzyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)pyrrolidin-3-amine.
| Compound Name | 1-benzyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 62065627 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 1-benzyl-N-(3,4-dihydro-2H-pyran-2-ylmethyl)pyrrolidin-3-amine |
| SMILES | C1=COC(CNC2CCN(Cc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C17H24N2O/c1-2-6-15(7-3-1)13-19-10-9-16(14-19)18-12-17-8-4-5-11-20-17/h1-3,5-7,11,16-18H,4,8-10,12-14H2 |
| InChIKey | REUVBXIRQWZXOK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |