C16H18N2O2S — CID 62078435
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine (PubChem CID 62078435) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
|---|---|
| PubChem CID | 62078435 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
| SMILES | CNC1CCCc2nc(-c3ccc4c(c3)OCCO4)sc21 |
| InChI | InChI=1S/C16H18N2O2S/c1-17-11-3-2-4-12-15(11)21-16(18-12)10-5-6-13-14(9-10)20-8-7-19-13/h5-6,9,11,17H,2-4,7-8H2,1H3 |
| InChIKey | YXLHUOJPRDPIJN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |