C12H10Br2FNO3S — CID 62084829
N-[(4,5-dibromofuran-2-yl)methyl]-2-fluoro-5-methylsulfonylaniline (PubChem CID 62084829) has the molecular formula C12H10Br2FNO3S and a molecular weight of 427.09 g/mol. Its IUPAC name is N-[(4,5-dibromofuran-2-yl)methyl]-2-fluoro-5-methylsulfonylaniline.
| Compound Name | N-[(4,5-dibromofuran-2-yl)methyl]-2-fluoro-5-methylsulfonylaniline |
|---|---|
| PubChem CID | 62084829 |
| Molecular Formula | C12H10Br2FNO3S |
| Molecular Weight | 427.09 g/mol |
| Exact Mass | 424.87 |
| IUPAC Name | N-[(4,5-dibromofuran-2-yl)methyl]-2-fluoro-5-methylsulfonylaniline |
| SMILES | CS(=O)(=O)c1ccc(F)c(NCc2cc(Br)c(Br)o2)c1 |
| InChI | InChI=1S/C12H10Br2FNO3S/c1-20(17,18)8-2-3-10(15)11(5-8)16-6-7-4-9(13)12(14)19-7/h2-5,16H,6H2,1H3 |
| InChIKey | PWVHKWXGHNSPRI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.09 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |