C16H23NO3 — CID 62086478
propan-2-yl 2-amino-6-(cyclopentyloxymethyl)benzoate (PubChem CID 62086478) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is propan-2-yl 2-amino-6-(cyclopentyloxymethyl)benzoate.
| Compound Name | propan-2-yl 2-amino-6-(cyclopentyloxymethyl)benzoate |
|---|---|
| PubChem CID | 62086478 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | propan-2-yl 2-amino-6-(cyclopentyloxymethyl)benzoate |
| SMILES | CC(C)OC(=O)c1c(N)cccc1COC1CCCC1 |
| InChI | InChI=1S/C16H23NO3/c1-11(2)20-16(18)15-12(6-5-9-14(15)17)10-19-13-7-3-4-8-13/h5-6,9,11,13H,3-4,7-8,10,17H2,1-2H3 |
| InChIKey | NCVINDWNWZEJFX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|