C12H14N2O5S — CID 62093728
5-(1-cyanopropan-2-ylsulfamoyl)-2-hydroxy-4-methylbenzoic acid (PubChem CID 62093728) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is 5-(1-cyanopropan-2-ylsulfamoyl)-2-hydroxy-4-methylbenzoic acid.
| Compound Name | 5-(1-cyanopropan-2-ylsulfamoyl)-2-hydroxy-4-methylbenzoic acid |
|---|---|
| PubChem CID | 62093728 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 5-(1-cyanopropan-2-ylsulfamoyl)-2-hydroxy-4-methylbenzoic acid |
| SMILES | Cc1cc(O)c(C(=O)O)cc1S(=O)(=O)NC(C)CC#N |
| InChI | InChI=1S/C12H14N2O5S/c1-7-5-10(15)9(12(16)17)6-11(7)20(18,19)14-8(2)3-4-13/h5-6,8,14-15H,3H2,1-2H3,(H,16,17) |
| InChIKey | QFYPALSMUWYFOT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |