C4H4N2O3 — CID 6211
1,3-diazinane-2,4,6-trione (PubChem CID 6211) has the molecular formula C4H4N2O3 and a molecular weight of 128.09 g/mol. Its IUPAC name is 1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6211 |
| Molecular Formula | C4H4N2O3 |
| Molecular Weight | 128.09 g/mol |
| Exact Mass | 128.02 |
| IUPAC Name | 1,3-diazinane-2,4,6-trione |
| SMILES | O=C1CC(=O)NC(=O)N1 |
| InChI | InChI=1S/C4H4N2O3/c7-2-1-3(8)6-4(9)5-2/h1H2,(H2,5,6,7,8,9) |
| InChIKey | HNYOPLTXPVRDBG-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.09 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|