C11H13BrN4OS — CID 62112892
2-(3-aminopyrazol-1-yl)-N-[(4-bromothiophen-2-yl)methyl]-N-methylacetamide (PubChem CID 62112892) has the molecular formula C11H13BrN4OS and a molecular weight of 329.22 g/mol. Its IUPAC name is 2-(3-aminopyrazol-1-yl)-N-[(4-bromothiophen-2-yl)methyl]-N-methylacetamide.
| Compound Name | 2-(3-aminopyrazol-1-yl)-N-[(4-bromothiophen-2-yl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 62112892 |
| Molecular Formula | C11H13BrN4OS |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 2-(3-aminopyrazol-1-yl)-N-[(4-bromothiophen-2-yl)methyl]-N-methylacetamide |
| SMILES | CN(Cc1cc(Br)cs1)C(=O)Cn1ccc(N)n1 |
| InChI | InChI=1S/C11H13BrN4OS/c1-15(5-9-4-8(12)7-18-9)11(17)6-16-3-2-10(13)14-16/h2-4,7H,5-6H2,1H3,(H2,13,14) |
| InChIKey | ZNZGDSAULFUSDT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |