C13H12ClF3N2 — CID 62116289
2-[2-chloro-3-[4-(trifluoromethyl)phenyl]propyl]-1H-imidazole (PubChem CID 62116289) has the molecular formula C13H12ClF3N2 and a molecular weight of 288.70 g/mol. Its IUPAC name is 2-[2-chloro-3-[4-(trifluoromethyl)phenyl]propyl]-1H-imidazole.
| Compound Name | 2-[2-chloro-3-[4-(trifluoromethyl)phenyl]propyl]-1H-imidazole |
|---|---|
| PubChem CID | 62116289 |
| Molecular Formula | C13H12ClF3N2 |
| Molecular Weight | 288.70 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-[2-chloro-3-[4-(trifluoromethyl)phenyl]propyl]-1H-imidazole |
| SMILES | FC(F)(F)c1ccc(CC(Cl)Cc2ncc[nH]2)cc1 |
| InChI | InChI=1S/C13H12ClF3N2/c14-11(8-12-18-5-6-19-12)7-9-1-3-10(4-2-9)13(15,16)17/h1-6,11H,7-8H2,(H,18,19) |
| InChIKey | PHVAIRJJTNXIGP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.70 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|