C16H26N2O2S — CID 62117847
N-hexan-3-yl-8-methyl-1,2,3,4-tetrahydroquinoline-5-sulfonamide (PubChem CID 62117847) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is N-hexan-3-yl-8-methyl-1,2,3,4-tetrahydroquinoline-5-sulfonamide.
| Compound Name | N-hexan-3-yl-8-methyl-1,2,3,4-tetrahydroquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 62117847 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-hexan-3-yl-8-methyl-1,2,3,4-tetrahydroquinoline-5-sulfonamide |
| SMILES | CCCC(CC)NS(=O)(=O)c1ccc(C)c2c1CCCN2 |
| InChI | InChI=1S/C16H26N2O2S/c1-4-7-13(5-2)18-21(19,20)15-10-9-12(3)16-14(15)8-6-11-17-16/h9-10,13,17-18H,4-8,11H2,1-3H3 |
| InChIKey | UUQUUEPWMBHRON-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |