C13H19N3O4S — CID 83205594
2-[(8-methyl-1,2,3,4-tetrahydroquinolin-5-yl)sulfonylamino]ethyl carbamate (PubChem CID 83205594) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-[(8-methyl-1,2,3,4-tetrahydroquinolin-5-yl)sulfonylamino]ethyl carbamate.
| Compound Name | 2-[(8-methyl-1,2,3,4-tetrahydroquinolin-5-yl)sulfonylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83205594 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-[(8-methyl-1,2,3,4-tetrahydroquinolin-5-yl)sulfonylamino]ethyl carbamate |
| SMILES | Cc1ccc(S(=O)(=O)NCCOC(N)=O)c2c1NCCC2 |
| InChI | InChI=1S/C13H19N3O4S/c1-9-4-5-11(10-3-2-6-15-12(9)10)21(18,19)16-7-8-20-13(14)17/h4-5,15-16H,2-3,6-8H2,1H3,(H2,14,17) |
| InChIKey | IIFLOUCZJYQYFU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|