C12H13N5 — CID 62118103
2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3H-isoindol-1-imine (PubChem CID 62118103) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3H-isoindol-1-imine.
| Compound Name | 2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3H-isoindol-1-imine |
|---|---|
| PubChem CID | 62118103 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3H-isoindol-1-imine |
| SMILES | [H]/N=C1/c2ccccc2CN1Cc1nncn1C |
| InChI | InChI=1S/C12H13N5/c1-16-8-14-15-11(16)7-17-6-9-4-2-3-5-10(9)12(17)13/h2-5,8,13H,6-7H2,1H3/b13-12- |
| InChIKey | XJUNEWAJNBNLLK-SEYXRHQNSA-N |
| XLogP | 1.16 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|