C13H14FN5 — CID 55203061
6-fluoro-2-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-3H-isoindol-1-imine (PubChem CID 55203061) has the molecular formula C13H14FN5 and a molecular weight of 259.29 g/mol. Its IUPAC name is 6-fluoro-2-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-3H-isoindol-1-imine.
| Compound Name | 6-fluoro-2-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-3H-isoindol-1-imine |
|---|---|
| PubChem CID | 55203061 |
| Molecular Formula | C13H14FN5 |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 6-fluoro-2-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-3H-isoindol-1-imine |
| SMILES | [H]/N=C1/c2cc(F)ccc2CN1CCc1nncn1C |
| InChI | InChI=1S/C13H14FN5/c1-18-8-16-17-12(18)4-5-19-7-9-2-3-10(14)6-11(9)13(19)15/h2-3,6,8,15H,4-5,7H2,1H3/b15-13- |
| InChIKey | PQVOHWLPLBNRFX-SQFISAMPSA-N |
| XLogP | 1.34 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|