C12H16FN3O2S — CID 106337066
N-[3-(5-fluoro-3-imino-1H-isoindol-2-yl)propyl]methanesulfonamide (PubChem CID 106337066) has the molecular formula C12H16FN3O2S and a molecular weight of 285.34 g/mol. Its IUPAC name is N-[3-(5-fluoro-3-imino-1H-isoindol-2-yl)propyl]methanesulfonamide.
| Compound Name | N-[3-(5-fluoro-3-imino-1H-isoindol-2-yl)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106337066 |
| Molecular Formula | C12H16FN3O2S |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-[3-(5-fluoro-3-imino-1H-isoindol-2-yl)propyl]methanesulfonamide |
| SMILES | [H]/N=C1/c2cc(F)ccc2CN1CCCNS(C)(=O)=O |
| InChI | InChI=1S/C12H16FN3O2S/c1-19(17,18)15-5-2-6-16-8-9-3-4-10(13)7-11(9)12(16)14/h3-4,7,14-15H,2,5-6,8H2,1H3/b14-12- |
| InChIKey | SDAJNHYIPZNIEA-OWBHPGMISA-N |
| XLogP | 0.91 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|