C15H22FN3 — CID 106033698
3-(5-fluoro-3-imino-1H-isoindol-2-yl)-N-methyl-N-propan-2-ylpropan-1-amine (PubChem CID 106033698) has the molecular formula C15H22FN3 and a molecular weight of 263.36 g/mol. Its IUPAC name is 3-(5-fluoro-3-imino-1H-isoindol-2-yl)-N-methyl-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-(5-fluoro-3-imino-1H-isoindol-2-yl)-N-methyl-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 106033698 |
| Molecular Formula | C15H22FN3 |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | 3-(5-fluoro-3-imino-1H-isoindol-2-yl)-N-methyl-N-propan-2-ylpropan-1-amine |
| SMILES | [H]/N=C1/c2cc(F)ccc2CN1CCCN(C)C(C)C |
| InChI | InChI=1S/C15H22FN3/c1-11(2)18(3)7-4-8-19-10-12-5-6-13(16)9-14(12)15(19)17/h5-6,9,11,17H,4,7-8,10H2,1-3H3/b17-15- |
| InChIKey | UWTDADDLHHHWRF-ICFOKQHNSA-N |
| XLogP | 2.70 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|