C15H19FN2 — CID 63536640
2-(2-cyclopentylethyl)-6-fluoro-3H-isoindol-1-imine (PubChem CID 63536640) has the molecular formula C15H19FN2 and a molecular weight of 246.33 g/mol. Its IUPAC name is 2-(2-cyclopentylethyl)-6-fluoro-3H-isoindol-1-imine.
| Compound Name | 2-(2-cyclopentylethyl)-6-fluoro-3H-isoindol-1-imine |
|---|---|
| PubChem CID | 63536640 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-(2-cyclopentylethyl)-6-fluoro-3H-isoindol-1-imine |
| SMILES | [H]/N=C1/c2cc(F)ccc2CN1CCC1CCCC1 |
| InChI | InChI=1S/C15H19FN2/c16-13-6-5-12-10-18(15(17)14(12)9-13)8-7-11-3-1-2-4-11/h5-6,9,11,17H,1-4,7-8,10H2/b17-15- |
| InChIKey | NOJNQQLFKSUHGU-ICFOKQHNSA-N |
| XLogP | 3.55 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|