C14H18FN3O — CID 63291837
3-(5-fluoro-3-imino-1H-isoindol-2-yl)-N-propylpropanamide (PubChem CID 63291837) has the molecular formula C14H18FN3O and a molecular weight of 263.32 g/mol. Its IUPAC name is 3-(5-fluoro-3-imino-1H-isoindol-2-yl)-N-propylpropanamide.
| Compound Name | 3-(5-fluoro-3-imino-1H-isoindol-2-yl)-N-propylpropanamide |
|---|---|
| PubChem CID | 63291837 |
| Molecular Formula | C14H18FN3O |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-(5-fluoro-3-imino-1H-isoindol-2-yl)-N-propylpropanamide |
| SMILES | [H]/N=C1/c2cc(F)ccc2CN1CCC(=O)NCCC |
| InChI | InChI=1S/C14H18FN3O/c1-2-6-17-13(19)5-7-18-9-10-3-4-11(15)8-12(10)14(18)16/h3-4,8,16H,2,5-7,9H2,1H3,(H,17,19)/b16-14- |
| InChIKey | FXPOOOMMGXODQY-PEZBUJJGSA-N |
| XLogP | 1.88 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|