C12H10FN3OS — CID 106381941
4-[(5-fluoro-3-imino-1H-isoindol-2-yl)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106381941) has the molecular formula C12H10FN3OS and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-[(5-fluoro-3-imino-1H-isoindol-2-yl)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(5-fluoro-3-imino-1H-isoindol-2-yl)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106381941 |
| Molecular Formula | C12H10FN3OS |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 4-[(5-fluoro-3-imino-1H-isoindol-2-yl)methyl]-3H-1,3-thiazol-2-one |
| SMILES | [H]/N=C1/c2cc(F)ccc2CN1Cc1csc(=O)[nH]1 |
| InChI | InChI=1S/C12H10FN3OS/c13-8-2-1-7-4-16(11(14)10(7)3-8)5-9-6-18-12(17)15-9/h1-3,6,14H,4-5H2,(H,15,17)/b14-11- |
| InChIKey | XPHAULTVIRPMRJ-KAMYIIQDSA-N |
| XLogP | 1.92 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|