C10H8F4N2 — CID 63291648
6-fluoro-2-(2,2,2-trifluoroethyl)-3H-isoindol-1-imine (PubChem CID 63291648) has the molecular formula C10H8F4N2 and a molecular weight of 232.18 g/mol. Its IUPAC name is 6-fluoro-2-(2,2,2-trifluoroethyl)-3H-isoindol-1-imine.
| Compound Name | 6-fluoro-2-(2,2,2-trifluoroethyl)-3H-isoindol-1-imine |
|---|---|
| PubChem CID | 63291648 |
| Molecular Formula | C10H8F4N2 |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 6-fluoro-2-(2,2,2-trifluoroethyl)-3H-isoindol-1-imine |
| SMILES | [H]/N=C1/c2cc(F)ccc2CN1CC(F)(F)F |
| InChI | InChI=1S/C10H8F4N2/c11-7-2-1-6-4-16(5-10(12,13)14)9(15)8(6)3-7/h1-3,15H,4-5H2/b15-9- |
| InChIKey | PCZXNPOMCYWQIH-DHDCSXOGSA-N |
| XLogP | 2.53 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|