C17H15FN2O — CID 63291528
2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-6-fluoro-3H-isoindol-1-imine (PubChem CID 63291528) has the molecular formula C17H15FN2O and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-6-fluoro-3H-isoindol-1-imine.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-6-fluoro-3H-isoindol-1-imine |
|---|---|
| PubChem CID | 63291528 |
| Molecular Formula | C17H15FN2O |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-6-fluoro-3H-isoindol-1-imine |
| SMILES | [H]/N=C1/c2cc(F)ccc2CN1CC1Cc2ccccc2O1 |
| InChI | InChI=1S/C17H15FN2O/c18-13-6-5-12-9-20(17(19)15(12)8-13)10-14-7-11-3-1-2-4-16(11)21-14/h1-6,8,14,19H,7,9-10H2/b19-17- |
| InChIKey | LOYSPCTXJDMLLL-ZPHPHTNESA-N |
| XLogP | 2.97 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|