C17H17FN2O — CID 66363550
1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2,3-dihydroindol-6-amine (PubChem CID 66363550) has the molecular formula C17H17FN2O and a molecular weight of 284.33 g/mol. Its IUPAC name is 1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2,3-dihydroindol-6-amine.
| Compound Name | 1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2,3-dihydroindol-6-amine |
|---|---|
| PubChem CID | 66363550 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2,3-dihydroindol-6-amine |
| SMILES | Nc1ccc2c(c1)N(CC1Cc3cc(F)ccc3O1)CC2 |
| InChI | InChI=1S/C17H17FN2O/c18-13-2-4-17-12(7-13)8-15(21-17)10-20-6-5-11-1-3-14(19)9-16(11)20/h1-4,7,9,15H,5-6,8,10,19H2 |
| InChIKey | ODGAHDKPAZOJGX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|