C15H12BrFO2 — CID 81332587
2-[(3-bromo-5-fluorophenoxy)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 81332587) has the molecular formula C15H12BrFO2 and a molecular weight of 323.16 g/mol. Its IUPAC name is 2-[(3-bromo-5-fluorophenoxy)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 2-[(3-bromo-5-fluorophenoxy)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 81332587 |
| Molecular Formula | C15H12BrFO2 |
| Molecular Weight | 323.16 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 2-[(3-bromo-5-fluorophenoxy)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | Fc1cc(Br)cc(OCC2Cc3ccccc3O2)c1 |
| InChI | InChI=1S/C15H12BrFO2/c16-11-6-12(17)8-13(7-11)18-9-14-5-10-3-1-2-4-15(10)19-14/h1-4,6-8,14H,5,9H2 |
| InChIKey | PYEQXUIDYNETHZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.16 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |