C12H15BrN4O — CID 62119001
2-(3-bromophenoxy)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]ethanamine (PubChem CID 62119001) has the molecular formula C12H15BrN4O and a molecular weight of 311.18 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]ethanamine.
| Compound Name | 2-(3-bromophenoxy)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 62119001 |
| Molecular Formula | C12H15BrN4O |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-(3-bromophenoxy)-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]ethanamine |
| SMILES | Cn1cnnc1CNCCOc1cccc(Br)c1 |
| InChI | InChI=1S/C12H15BrN4O/c1-17-9-15-16-12(17)8-14-5-6-18-11-4-2-3-10(13)7-11/h2-4,7,9,14H,5-6,8H2,1H3 |
| InChIKey | NRJPFVCLCXMFRB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|