C26H19NO5S — CID 6213361
[2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate (PubChem CID 6213361) has the molecular formula C26H19NO5S and a molecular weight of 457.51 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate.
| Compound Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6213361 |
| Molecular Formula | C26H19NO5S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate |
| SMILES | CSc1ccc(/C=C/C(=O)OCC(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C26H19NO5S/c1-33-18-10-6-16(7-11-18)8-13-24(29)32-15-23(28)27-17-9-12-21-22(14-17)26(31)20-5-3-2-4-19(20)25(21)30/h2-14H,15H2,1H3,(H,27,28)/b13-8+ |
| InChIKey | ZYQOIDHSDACUMS-MDWZMJQESA-N |
| XLogP | 4.38 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|