C16H15NO3S2 — CID 7549886
[2-(3-methylsulfanylanilino)-2-oxoethyl] (E)-3-thiophen-3-ylprop-2-enoate (PubChem CID 7549886) has the molecular formula C16H15NO3S2 and a molecular weight of 333.43 g/mol. Its IUPAC name is [2-(3-methylsulfanylanilino)-2-oxoethyl] (E)-3-thiophen-3-ylprop-2-enoate.
| Compound Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] (E)-3-thiophen-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 7549886 |
| Molecular Formula | C16H15NO3S2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] (E)-3-thiophen-3-ylprop-2-enoate |
| SMILES | CSc1cccc(NC(=O)COC(=O)/C=C/c2ccsc2)c1 |
| InChI | InChI=1S/C16H15NO3S2/c1-21-14-4-2-3-13(9-14)17-15(18)10-20-16(19)6-5-12-7-8-22-11-12/h2-9,11H,10H2,1H3,(H,17,18)/b6-5+ |
| InChIKey | RIEAHXDFRBLTNX-AATRIKPKSA-N |
| XLogP | 3.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|