C7H10N4O2S2 — CID 62145089
6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 62145089) has the molecular formula C7H10N4O2S2 and a molecular weight of 246.32 g/mol. Its IUPAC name is 6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 62145089 |
| Molecular Formula | C7H10N4O2S2 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | CCNc1nc2sccn2c1S(N)(=O)=O |
| InChI | InChI=1S/C7H10N4O2S2/c1-2-9-5-6(15(8,12)13)11-3-4-14-7(11)10-5/h3-4,9H,2H2,1H3,(H2,8,12,13) |
| InChIKey | ACBCTABQKIFBDE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |