About 6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide
6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 62145089) has the molecular formula C7H10N4O2S2
and a molecular weight of 246.32 g/mol. Its IUPAC name is 6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| PubChem CID | 62145089 |
| Molecular Formula | C7H10N4O2S2 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | CCNc1nc2sccn2c1S(N)(=O)=O |
| InChI | InChI=1S/C7H10N4O2S2/c1-2-9-5-6(15(8,12)13)11-3-4-14-7(11)10-5/h3-4,9H,2H2,1H3,(H2,8,12,13) |
| InChIKey | ACBCTABQKIFBDE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide?
The IUPAC name of 6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (CID 62145089) is 6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
What is the SMILES notation for 6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide?
The canonical SMILES for 6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide is CCNc1nc2sccn2c1S(N)(=O)=O.
What is the InChIKey of 6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide?
The InChIKey is ACBCTABQKIFBDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2S2/c1-2-9-5-6(15(8,12)13)11-3-4-14-7(11)10-5/h3-4,9H,2H2,1H3,(H2,8,12,13).
What are the key properties of 6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide?
6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide has a molecular weight of 246.32 g/mol, XLogP of 0.47, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(ethylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide is sourced from PubChem (CID 62145089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).