C6H6ClN3O2S2 — CID 14422482
6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 14422482) has the molecular formula C6H6ClN3O2S2 and a molecular weight of 251.72 g/mol. Its IUPAC name is 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 14422482 |
| Molecular Formula | C6H6ClN3O2S2 |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 250.96 |
| IUPAC Name | 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1c(CCl)nc2sccn12 |
| InChI | InChI=1S/C6H6ClN3O2S2/c7-3-4-5(14(8,11)12)10-1-2-13-6(10)9-4/h1-2H,3H2,(H2,8,11,12) |
| InChIKey | VTGCOGJSDDNOKN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|