About 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide
6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 14422482) has the molecular formula C6H6ClN3O2S2
and a molecular weight of 251.72 g/mol. Its IUPAC name is 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| PubChem CID | 14422482 |
| Molecular Formula | C6H6ClN3O2S2 |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 250.96 |
| IUPAC Name | 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1c(CCl)nc2sccn12 |
| InChI | InChI=1S/C6H6ClN3O2S2/c7-3-4-5(14(8,11)12)10-1-2-13-6(10)9-4/h1-2H,3H2,(H2,8,11,12) |
| InChIKey | VTGCOGJSDDNOKN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide?
The IUPAC name of 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (CID 14422482) is 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
What is the SMILES notation for 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide?
The canonical SMILES for 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide is NS(=O)(=O)c1c(CCl)nc2sccn12.
What is the InChIKey of 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide?
The InChIKey is VTGCOGJSDDNOKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN3O2S2/c7-3-4-5(14(8,11)12)10-1-2-13-6(10)9-4/h1-2H,3H2,(H2,8,11,12).
What are the key properties of 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide?
6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide has a molecular weight of 251.72 g/mol, XLogP of 0.78, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide is sourced from PubChem (CID 14422482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).