C5H3BrN2O3S2 — CID 14422476
6-bromoimidazo[2,1-b][1,3]thiazole-5-sulfonic acid (PubChem CID 14422476) has the molecular formula C5H3BrN2O3S2 and a molecular weight of 283.13 g/mol. Its IUPAC name is 6-bromoimidazo[2,1-b][1,3]thiazole-5-sulfonic acid.
| Compound Name | 6-bromoimidazo[2,1-b][1,3]thiazole-5-sulfonic acid |
|---|---|
| PubChem CID | 14422476 |
| Molecular Formula | C5H3BrN2O3S2 |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 281.88 |
| IUPAC Name | 6-bromoimidazo[2,1-b][1,3]thiazole-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1c(Br)nc2sccn12 |
| InChI | InChI=1S/C5H3BrN2O3S2/c6-3-4(13(9,10)11)8-1-2-12-5(8)7-3/h1-2H,(H,9,10,11) |
| InChIKey | FBJJVQIPRUONDZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|