C15H14BrFN2O2 — CID 6214664
(Z)-3-(5-bromo-2-fluorophenyl)-2-cyano-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 6214664) has the molecular formula C15H14BrFN2O2 and a molecular weight of 353.19 g/mol. Its IUPAC name is (Z)-3-(5-bromo-2-fluorophenyl)-2-cyano-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (Z)-3-(5-bromo-2-fluorophenyl)-2-cyano-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 6214664 |
| Molecular Formula | C15H14BrFN2O2 |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | (Z)-3-(5-bromo-2-fluorophenyl)-2-cyano-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1cc(Br)ccc1F)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C15H14BrFN2O2/c16-12-3-4-14(17)10(7-12)6-11(8-18)15(20)19-9-13-2-1-5-21-13/h3-4,6-7,13H,1-2,5,9H2,(H,19,20)/b11-6- |
| InChIKey | INKMNZAXPZMYOG-WDZFZDKYSA-N |
| XLogP | 2.79 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|