C12H17N5O2S — CID 62149839
3-(4-methylpiperazin-1-yl)sulfonylimidazo[1,2-a]pyridin-2-amine (PubChem CID 62149839) has the molecular formula C12H17N5O2S and a molecular weight of 295.37 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)sulfonylimidazo[1,2-a]pyridin-2-amine.
| Compound Name | 3-(4-methylpiperazin-1-yl)sulfonylimidazo[1,2-a]pyridin-2-amine |
|---|---|
| PubChem CID | 62149839 |
| Molecular Formula | C12H17N5O2S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)sulfonylimidazo[1,2-a]pyridin-2-amine |
| SMILES | CN1CCN(S(=O)(=O)c2c(N)nc3ccccn23)CC1 |
| InChI | InChI=1S/C12H17N5O2S/c1-15-6-8-16(9-7-15)20(18,19)12-11(13)14-10-4-2-3-5-17(10)12/h2-5H,6-9,13H2,1H3 |
| InChIKey | GQIXPFMASOLDNL-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 83.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |