C11H16BrN3O2S2 — CID 62152979
5-bromo-N-methyl-3-(1,4-thiazepan-4-ylsulfonyl)pyridin-2-amine (PubChem CID 62152979) has the molecular formula C11H16BrN3O2S2 and a molecular weight of 366.31 g/mol. Its IUPAC name is 5-bromo-N-methyl-3-(1,4-thiazepan-4-ylsulfonyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-methyl-3-(1,4-thiazepan-4-ylsulfonyl)pyridin-2-amine |
|---|---|
| PubChem CID | 62152979 |
| Molecular Formula | C11H16BrN3O2S2 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 5-bromo-N-methyl-3-(1,4-thiazepan-4-ylsulfonyl)pyridin-2-amine |
| SMILES | CNc1ncc(Br)cc1S(=O)(=O)N1CCCSCC1 |
| InChI | InChI=1S/C11H16BrN3O2S2/c1-13-11-10(7-9(12)8-14-11)19(16,17)15-3-2-5-18-6-4-15/h7-8H,2-6H2,1H3,(H,13,14) |
| InChIKey | KUKPMDVTAZUWEM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |