C29H26N4O3 — CID 6215974
[1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl] (E)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enoate (PubChem CID 6215974) has the molecular formula C29H26N4O3 and a molecular weight of 478.55 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl] (E)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl] (E)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 6215974 |
| Molecular Formula | C29H26N4O3 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | [1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl] (E)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1cn(-c2ccccc2)nc1-c1cccnc1)C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C29H26N4O3/c1-21(29(35)32-18-8-11-22-9-5-6-14-26(22)32)36-27(34)16-15-24-20-33(25-12-3-2-4-13-25)31-28(24)23-10-7-17-30-19-23/h2-7,9-10,12-17,19-21H,8,11,18H2,1H3/b16-15+ |
| InChIKey | VQUCXHSWYWXVIQ-FOCLMDBBSA-N |
| XLogP | 4.86 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|