C17H21N3 — CID 62182330
5-(3,4-dihydro-2H-quinolin-1-ylmethyl)-N-ethylpyridin-2-amine (PubChem CID 62182330) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-quinolin-1-ylmethyl)-N-ethylpyridin-2-amine.
| Compound Name | 5-(3,4-dihydro-2H-quinolin-1-ylmethyl)-N-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 62182330 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 5-(3,4-dihydro-2H-quinolin-1-ylmethyl)-N-ethylpyridin-2-amine |
| SMILES | CCNc1ccc(CN2CCCc3ccccc32)cn1 |
| InChI | InChI=1S/C17H21N3/c1-2-18-17-10-9-14(12-19-17)13-20-11-5-7-15-6-3-4-8-16(15)20/h3-4,6,8-10,12H,2,5,7,11,13H2,1H3,(H,18,19) |
| InChIKey | REWRKTZNFTXBAO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |