C23H19N3O7S — CID 6218496
[2-(2-nitroanilino)-2-oxoethyl] 4-[[(E)-2-phenylethenyl]sulfonylamino]benzoate (PubChem CID 6218496) has the molecular formula C23H19N3O7S and a molecular weight of 481.49 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] 4-[[(E)-2-phenylethenyl]sulfonylamino]benzoate.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] 4-[[(E)-2-phenylethenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 6218496 |
| Molecular Formula | C23H19N3O7S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] 4-[[(E)-2-phenylethenyl]sulfonylamino]benzoate |
| SMILES | O=C(COC(=O)c1ccc(NS(=O)(=O)/C=C/c2ccccc2)cc1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H19N3O7S/c27-22(24-20-8-4-5-9-21(20)26(29)30)16-33-23(28)18-10-12-19(13-11-18)25-34(31,32)15-14-17-6-2-1-3-7-17/h1-15,25H,16H2,(H,24,27)/b15-14+ |
| InChIKey | SEEQNJKFUHZFRL-CCEZHUSRSA-N |
| XLogP | 3.80 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|