C20H21BrN4O6S — CID 6218604
2-methoxyethyl (2E)-2-[[3-[(2-bromo-5-methylphenyl)sulfamoyl]-4-methoxyphenyl]hydrazinylidene]-2-cyanoacetate (PubChem CID 6218604) has the molecular formula C20H21BrN4O6S and a molecular weight of 525.38 g/mol. Its IUPAC name is 2-methoxyethyl (2E)-2-[[3-[(2-bromo-5-methylphenyl)sulfamoyl]-4-methoxyphenyl]hydrazinylidene]-2-cyanoacetate.
| Compound Name | 2-methoxyethyl (2E)-2-[[3-[(2-bromo-5-methylphenyl)sulfamoyl]-4-methoxyphenyl]hydrazinylidene]-2-cyanoacetate |
|---|---|
| PubChem CID | 6218604 |
| Molecular Formula | C20H21BrN4O6S |
| Molecular Weight | 525.38 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | 2-methoxyethyl (2E)-2-[[3-[(2-bromo-5-methylphenyl)sulfamoyl]-4-methoxyphenyl]hydrazinylidene]-2-cyanoacetate |
| SMILES | COCCOC(=O)/C(C#N)=N/Nc1ccc(OC)c(S(=O)(=O)Nc2cc(C)ccc2Br)c1 |
| InChI | InChI=1S/C20H21BrN4O6S/c1-13-4-6-15(21)16(10-13)25-32(27,28)19-11-14(5-7-18(19)30-3)23-24-17(12-22)20(26)31-9-8-29-2/h4-7,10-11,23,25H,8-9H2,1-3H3/b24-17+ |
| InChIKey | MGGPTZZOMZZPCA-JJIBRWJFSA-N |
| XLogP | 3.05 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|