C12H11N3 — CID 62189882
4-amino-5,7-dimethylquinoline-3-carbonitrile (PubChem CID 62189882) has the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-amino-5,7-dimethylquinoline-3-carbonitrile.
| Compound Name | 4-amino-5,7-dimethylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 62189882 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 4-amino-5,7-dimethylquinoline-3-carbonitrile |
| SMILES | Cc1cc(C)c2c(N)c(C#N)cnc2c1 |
| InChI | InChI=1S/C12H11N3/c1-7-3-8(2)11-10(4-7)15-6-9(5-13)12(11)14/h3-4,6H,1-2H3,(H2,14,15) |
| InChIKey | NKDYNSRQDYWEKM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |