About 5-(4-amino-5,6-dimethylpyrimidin-2-yl)-2-methoxyphenol
5-(4-amino-5,6-dimethylpyrimidin-2-yl)-2-methoxyphenol (PubChem CID 62202667) has the molecular formula C13H15N3O2
and a molecular weight of 245.28 g/mol. Its IUPAC name is 5-(4-amino-5,6-dimethylpyrimidin-2-yl)-2-methoxyphenol.
Molecular Properties
| Compound Name | 5-(4-amino-5,6-dimethylpyrimidin-2-yl)-2-methoxyphenol |
| PubChem CID | 62202667 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 5-(4-amino-5,6-dimethylpyrimidin-2-yl)-2-methoxyphenol |
| SMILES | COc1ccc(-c2nc(C)c(C)c(N)n2)cc1O |
| InChI | InChI=1S/C13H15N3O2/c1-7-8(2)15-13(16-12(7)14)9-4-5-11(18-3)10(17)6-9/h4-6,17H,1-3H3,(H2,14,15,16) |
| InChIKey | ZVAMOSKYFSYAPZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-amino-5,6-dimethylpyrimidin-2-yl)-2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-amino-5,6-dimethylpyrimidin-2-yl)-2-methoxyphenol?
The IUPAC name of 5-(4-amino-5,6-dimethylpyrimidin-2-yl)-2-methoxyphenol (CID 62202667) is 5-(4-amino-5,6-dimethylpyrimidin-2-yl)-2-methoxyphenol.
What is the SMILES notation for 5-(4-amino-5,6-dimethylpyrimidin-2-yl)-2-methoxyphenol?
The canonical SMILES for 5-(4-amino-5,6-dimethylpyrimidin-2-yl)-2-methoxyphenol is COc1ccc(-c2nc(C)c(C)c(N)n2)cc1O.
What is the InChIKey of 5-(4-amino-5,6-dimethylpyrimidin-2-yl)-2-methoxyphenol?
The InChIKey is ZVAMOSKYFSYAPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2/c1-7-8(2)15-13(16-12(7)14)9-4-5-11(18-3)10(17)6-9/h4-6,17H,1-3H3,(H2,14,15,16).
What are the key properties of 5-(4-amino-5,6-dimethylpyrimidin-2-yl)-2-methoxyphenol?
5-(4-amino-5,6-dimethylpyrimidin-2-yl)-2-methoxyphenol has a molecular weight of 245.28 g/mol, XLogP of 2.06, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-amino-5,6-dimethylpyrimidin-2-yl)-2-methoxyphenol is sourced from PubChem (CID 62202667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).