C9H13N5O2 — CID 62208843
3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 62208843) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is 3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 62208843 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1nn(C)c(N)c1CN1C(=O)CNC1=O |
| InChI | InChI=1S/C9H13N5O2/c1-5-6(8(10)13(2)12-5)4-14-7(15)3-11-9(14)16/h3-4,10H2,1-2H3,(H,11,16) |
| InChIKey | YNNWEOHVSBRTDX-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|